CAS 77297-00-8 appears in our catalog under these names: 1,1-Diethylguanidine sulfate, 98%, 1,1–Diethylguanidine Sulfate, 1,1-Diethylguanidine Sulfate, >98.0%(T), 1,1-Diethylguanidine Sulfate, 98%,RG, 98%,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
Bis((E)-carbamimidoyl-ethyl-ethylideneazanium);sulfate (CAS 77297-00-8) is a chemical compound with the molecular formula C10H24N6O4S and a molecular weight of 324.40 g/mol. IUPAC name: bis((E)-carbamimidoyl-ethyl-ethylideneazanium);sulfate. InChIKey: NLMZLFQEKYGWPF-IFGWCFFNSA-L.
| Molecular formula | C10H24N6O4S |
|---|---|
| Molecular weight | 324.40 g/mol |
| IUPAC name | bis((E)-carbamimidoyl-ethyl-ethylideneazanium);sulfate |
| InChIKey | NLMZLFQEKYGWPF-IFGWCFFNSA-L |
| SMILES | CC/[N+](=C\C)/C(=N)N.CC/[N+](=C\C)/C(=N)N.[O-]S(=O)(=O)[O-] |
Computed by PubChem (NCBI)