Products 786-22-1
CAS 786-22-1 is the registry number for 4-Fluoro-2-[(4-fluorophenyl)sulfonyl]phenol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-fluoro-2-(4-fluorophenyl)sulfonylphenol (CAS 786-22-1) is a chemical compound with the molecular formula C12H8F2O3S and a molecular weight of 270.25 g/mol. IUPAC name: 4-fluoro-2-(4-fluorophenyl)sulfonylphenol. InChIKey: PUFAXSNZICIQEX-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O3S |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 4-fluoro-2-(4-fluorophenyl)sulfonylphenol |
| InChIKey | PUFAXSNZICIQEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)C2=C(C=CC(=C2)F)O |
Computed by PubChem (NCBI)