Products 790267-88-8
CAS 790267-88-8 is the registry number for WAY-635764, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
[2-(3,4-dimethylanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (CAS 790267-88-8) is a chemical compound with the molecular formula C23H31N3O5 and a molecular weight of 429.5 g/mol. IUPAC name: [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate. InChIKey: RMMGXSBJHGTGKC-UHFFFAOYSA-N.
| Molecular formula | C23H31N3O5 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| InChIKey | RMMGXSBJHGTGKC-UHFFFAOYSA-N |
| SMILES | CC1CC(CC2(C1)C(=O)N(C(=O)N2)CC(=O)OCC(=O)NC3=CC(=C(C=C3)C)C)(C)C |
Computed by PubChem (NCBI)