Products 80180-01-4
CAS 80180-01-4 is the registry number for 2,2,3,3,3-Pentafluoro-1-(4-fluorophenyl)-1-propanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)propan-1-one (CAS 80180-01-4) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)propan-1-one. InChIKey: VSASPYIRUOYPTL-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)propan-1-one |
| InChIKey | VSASPYIRUOYPTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)