CAS 81439-78-3 is the registry number for DL-2-Azido-3-Methylbutanoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-azido-3-methylbutanoic acid (CAS 81439-78-3) is a chemical compound with the molecular formula C5H9N3O2 and a molecular weight of 143.14 g/mol. IUPAC name: 2-azido-3-methylbutanoic acid. InChIKey: PEEUITQAXNZZPU-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O2 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | 2-azido-3-methylbutanoic acid |
| InChIKey | PEEUITQAXNZZPU-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)