Products 81439-78-3

CAS 81439-78-3 is the registry number for DL-2-Azido-3-Methylbutanoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-azido-3-methylbutanoic acid (CAS 81439-78-3) is a chemical compound with the molecular formula C5H9N3O2 and a molecular weight of 143.14 g/mol. IUPAC name: 2-azido-3-methylbutanoic acid. InChIKey: PEEUITQAXNZZPU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9N3O2
Molecular weight143.14 g/mol
IUPAC name2-azido-3-methylbutanoic acid
InChIKeyPEEUITQAXNZZPU-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)