CAS 824430-78-6 is the registry number for Lorcaserin L-Tartrate. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 824430-78-6) is a chemical compound with the molecular formula C15H20ClNO6 and a molecular weight of 345.77 g/mol. IUPAC name: (5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: AYEYPPGCJSRUAN-YIDNRZKSSA-N.
| Molecular formula | C15H20ClNO6 |
|---|---|
| Molecular weight | 345.77 g/mol |
| IUPAC name | (5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | AYEYPPGCJSRUAN-YIDNRZKSSA-N |
| SMILES | C[C@H]1CNCCC2=C1C=C(C=C2)Cl.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)