CAS 833473-87-3 is the registry number for tert-Butyl (2S,4S)-2-ethynyl-4-fluoropyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2S,4S)-2-ethynyl-4-fluoropyrrolidine-1-carboxylate (CAS 833473-87-3) is a chemical compound with the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. IUPAC name: tert-butyl (2S,4S)-2-ethynyl-4-fluoropyrrolidine-1-carboxylate. InChIKey: HWMFGFNYGXCRMZ-DTWKUNHWSA-N.
| Molecular formula | C11H16FNO2 |
|---|---|
| Molecular weight | 213.25 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-ethynyl-4-fluoropyrrolidine-1-carboxylate |
| InChIKey | HWMFGFNYGXCRMZ-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C#C)F |
Computed by PubChem (NCBI)