Products 83426-49-7
CAS 83426-49-7 is the registry number for N-(3,5-dichlorophenyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(3,5-dichlorophenyl)benzamide (CAS 83426-49-7) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: N-(3,5-dichlorophenyl)benzamide. InChIKey: JNKXMQUTCCJEDI-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | N-(3,5-dichlorophenyl)benzamide |
| InChIKey | JNKXMQUTCCJEDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)