CAS 844856-31-1 is the registry number for 3,5-Difluoro-α-(4-fluorophenyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3,5-difluorophenyl)-(4-fluorophenyl)methanol (CAS 844856-31-1) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: (3,5-difluorophenyl)-(4-fluorophenyl)methanol. InChIKey: LQWBSFQCDFKNBG-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | (3,5-difluorophenyl)-(4-fluorophenyl)methanol |
| InChIKey | LQWBSFQCDFKNBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC(=CC(=C2)F)F)O)F |
Computed by PubChem (NCBI)