Products 84811-88-1

CAS 84811-88-1 is the registry number for 10-(Pyren-1-yl)decan-1-ol 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

10-pyren-1-yldecan-1-ol (CAS 84811-88-1) is a chemical compound with the molecular formula C26H30O and a molecular weight of 358.5 g/mol. IUPAC name: 10-pyren-1-yldecan-1-ol. InChIKey: WCPVAPUGWVEFCN-UHFFFAOYSA-N.

Identity
Molecular formulaC26H30O
Molecular weight358.5 g/mol
IUPAC name10-pyren-1-yldecan-1-ol
InChIKeyWCPVAPUGWVEFCN-UHFFFAOYSA-N
SMILESC1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCCCCCCCCO

Computed by PubChem (NCBI)