Products 849042-95-1
CAS 849042-95-1 is the registry number for 3-formyl-2-oxo-2H-chromen-7-yl acetate, 96%, 96%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(3-formyl-2-oxochromen-7-yl) acetate (CAS 849042-95-1) is a chemical compound with the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. IUPAC name: (3-formyl-2-oxochromen-7-yl) acetate. InChIKey: QZFHRSSZNGRMDS-UHFFFAOYSA-N.
| Molecular formula | C12H8O5 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | (3-formyl-2-oxochromen-7-yl) acetate |
| InChIKey | QZFHRSSZNGRMDS-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=C(C(=O)O2)C=O |
Computed by PubChem (NCBI)
Synonyms:
3-formyl-2-oxo-2H-chromen-7-yl acetate