CAS 850363-43-8 is the registry number for tert-butyl N-{1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl}carbamate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate (CAS 850363-43-8) is a chemical compound with the molecular formula C19H30BNO4 and a molecular weight of 347.3 g/mol. IUPAC name: tert-butyl N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate. InChIKey: CPLFZBDHCQYOBY-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | tert-butyl N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
| InChIKey | CPLFZBDHCQYOBY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)