Products 85146-09-4
CAS 85146-09-4 is the registry number for AK-toxin Ⅰ. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E,6E)-8-(2-acetamido-3-phenylbutanoyl)oxy-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid (CAS 85146-09-4) is a chemical compound with the molecular formula C23H27NO6 and a molecular weight of 413.5 g/mol. IUPAC name: (2E,4E,6E)-8-(2-acetamido-3-phenylbutanoyl)oxy-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid. InChIKey: HGSOUJPIFSDBKJ-FGTVCLKNSA-N.
| Molecular formula | C23H27NO6 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2E,4E,6E)-8-(2-acetamido-3-phenylbutanoyl)oxy-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid |
| InChIKey | HGSOUJPIFSDBKJ-FGTVCLKNSA-N |
| SMILES | CC(C1=CC=CC=C1)C(C(=O)OC(/C=C/C=C/C=C/C(=O)O)C2(CO2)C)NC(=O)C |
Computed by PubChem (NCBI)