Products 851627-80-0
CAS 851627-80-0 is the registry number for PR-104 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
CAS 851627-80-0 identifies a chemical compound with the molecular formula C14H20BrN4NaO12PS and a molecular weight of 602.3 g/mol. InChIKey: WQCXXHGWABIMCR-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN4NaO12PS |
|---|---|
| Molecular weight | 602.3 g/mol |
| InChIKey | WQCXXHGWABIMCR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCN(CCBr)C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)NCCOP(=O)(O)O.[Na] |
Computed by PubChem (NCBI)