Products 853709-75-8
CAS 853709-75-8 is the registry number for WAY-323259-10mMinDMSO,,, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide (CAS 853709-75-8) is a chemical compound with the molecular formula C27H29N3O4S and a molecular weight of 491.6 g/mol. IUPAC name: 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide. InChIKey: ZQTFPVDSMJLEJW-UHFFFAOYSA-N.
| Molecular formula | C27H29N3O4S |
|---|---|
| Molecular weight | 491.6 g/mol |
| IUPAC name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide |
| InChIKey | ZQTFPVDSMJLEJW-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(C3=CC=CC=C3)C(=O)NC4=CC(=CC=C4)S(=O)(=O)N5CCOCC5 |
Computed by PubChem (NCBI)