CAS 855239-61-1 appears in our catalog under these names: 3,3''-Diiodo-5'-(3-iodophenyl)-1,1':3',1''-terphenyl, 98%, 1,3,5–Tris(m–iodophenyl)benzene, 3,3''-Diiodo-5'-(3-iodophenyl)-1,1':3',1''-terphenyl, 98%, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg.
1,3,5-tris(3-iodophenyl)benzene (CAS 855239-61-1) is a chemical compound with the molecular formula C24H15I3 and a molecular weight of 684.1 g/mol. IUPAC name: 1,3,5-tris(3-iodophenyl)benzene. InChIKey: IYUNFCULUCQLBM-UHFFFAOYSA-N.
| Molecular formula | C24H15I3 |
|---|---|
| Molecular weight | 684.1 g/mol |
| IUPAC name | 1,3,5-tris(3-iodophenyl)benzene |
| InChIKey | IYUNFCULUCQLBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)C2=CC(=CC(=C2)C3=CC(=CC=C3)I)C4=CC(=CC=C4)I |
Computed by PubChem (NCBI)