CAS 860644-28-6 appears in our catalog under these names: Losartan Isomer Impurity, Potassium Salt, >95% (HPLC), Losartan isomer impurity, potassium salt, Losartan EP Impurity C. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 10mg, 25mg, 5mg, 2mg, 1mg, on request.
Potassium [2-butyl-5-chloro-1-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanolate (CAS 860644-28-6) is a chemical compound with the molecular formula C22H22ClKN6O and a molecular weight of 465.0 g/mol. IUPAC name: potassium [2-butyl-5-chloro-1-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanolate. InChIKey: WBEUZWUCMDLLLJ-OKYQSVLFSA-N.
| Molecular formula | C22H22ClKN6O |
|---|---|
| Molecular weight | 465.0 g/mol |
| IUPAC name | potassium [2-butyl-5-chloro-1-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanolate |
| InChIKey | WBEUZWUCMDLLLJ-OKYQSVLFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CN2C(=NC(=C2Cl)C[O-])CCCC)[2H])[2H])C3=CC=CC=C3C4=NNN=N4)[2H].[K+] |
Computed by PubChem (NCBI)