CAS 864066-99-9 is the registry number for 5-Bromo-2-(1-methylethoxy)-1,3-bis(1-methylethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1,3-di(propan-2-yl)-2-propan-2-yloxybenzene (CAS 864066-99-9) is a chemical compound with the molecular formula C15H23BrO and a molecular weight of 299.25 g/mol. IUPAC name: 5-bromo-1,3-di(propan-2-yl)-2-propan-2-yloxybenzene. InChIKey: IIDCCGFOZNSDSZ-UHFFFAOYSA-N.
| Molecular formula | C15H23BrO |
|---|---|
| Molecular weight | 299.25 g/mol |
| IUPAC name | 5-bromo-1,3-di(propan-2-yl)-2-propan-2-yloxybenzene |
| InChIKey | IIDCCGFOZNSDSZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1OC(C)C)C(C)C)Br |
Computed by PubChem (NCBI)