Products 869354-47-2
CAS 869354-47-2 is the registry number for WAY-325641, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
1-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone (CAS 869354-47-2) is a chemical compound with the molecular formula C21H25N5O2S and a molecular weight of 411.5 g/mol. IUPAC name: 1-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone. InChIKey: SCOPOHGXBHMNOC-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O2S |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 1-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone |
| InChIKey | SCOPOHGXBHMNOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=NN=N2)SCC(=O)C3=C(N(C(=C3)C)CC4CCCO4)C |
Computed by PubChem (NCBI)