Products 869493-26-5
CAS 869493-26-5 is the registry number for VRX-03011. Offered by: MedChemExpress. Available pack sizes: Get quote.
Potassium 6-oxo-5-(3-piperidin-1-ylpropylcarbamoyl)-7-propan-2-ylthieno[2,3-b]pyridin-4-olate (CAS 869493-26-5) is a chemical compound with the molecular formula C19H26KN3O3S and a molecular weight of 415.6 g/mol. IUPAC name: potassium 6-oxo-5-(3-piperidin-1-ylpropylcarbamoyl)-7-propan-2-ylthieno[2,3-b]pyridin-4-olate. InChIKey: JWRDEPYIIBDWDI-UHFFFAOYSA-M.
| Molecular formula | C19H26KN3O3S |
|---|---|
| Molecular weight | 415.6 g/mol |
| IUPAC name | potassium 6-oxo-5-(3-piperidin-1-ylpropylcarbamoyl)-7-propan-2-ylthieno[2,3-b]pyridin-4-olate |
| InChIKey | JWRDEPYIIBDWDI-UHFFFAOYSA-M |
| SMILES | CC(C)N1C2=C(C=CS2)C(=C(C1=O)C(=O)NCCCN3CCCCC3)[O-].[K+] |
Computed by PubChem (NCBI)