CAS 869872-97-9 is the registry number for WAY-326270-A-10mMinDMSO,,, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
[2-(3-methoxyanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (CAS 869872-97-9) is a chemical compound with the molecular formula C22H29N3O6 and a molecular weight of 431.5 g/mol. IUPAC name: [2-(3-methoxyanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate. InChIKey: XSBRQTXIKQDVPY-UHFFFAOYSA-N.
| Molecular formula | C22H29N3O6 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | [2-(3-methoxyanilino)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| InChIKey | XSBRQTXIKQDVPY-UHFFFAOYSA-N |
| SMILES | CC1CC(CC2(C1)C(=O)N(C(=O)N2)CC(=O)OCC(=O)NC3=CC(=CC=C3)OC)(C)C |
Computed by PubChem (NCBI)