CAS 869959-17-1 is the registry number for 2',3',5',6'-Tetrafluoro-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2,3,5,6-tetrafluoro-4-(4-formylphenyl)phenyl]benzaldehyde (CAS 869959-17-1) is a chemical compound with the molecular formula C20H10F4O2 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[2,3,5,6-tetrafluoro-4-(4-formylphenyl)phenyl]benzaldehyde. InChIKey: MPNYHSBCTJMZAD-UHFFFAOYSA-N.
| Molecular formula | C20H10F4O2 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[2,3,5,6-tetrafluoro-4-(4-formylphenyl)phenyl]benzaldehyde |
| InChIKey | MPNYHSBCTJMZAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C(=C(C(=C2F)F)C3=CC=C(C=C3)C=O)F)F |
Computed by PubChem (NCBI)