CAS 872595-06-7 is the registry number for (1R,2R)-1,2-di-p-tolylethane-1,2-diamine, ≥97%(HPLC),≥99%(ee), ≥97%(HPLC),≥99%(ee). Offered by: Chemat. Available pack sizes: 100mg, 500mg, 1g.
(1R,2R)-1,2-bis(4-methylphenyl)ethane-1,2-diamine (CAS 872595-06-7) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2R)-1,2-bis(4-methylphenyl)ethane-1,2-diamine. InChIKey: UQUZLWQGLCLOBD-HZPDHXFCSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(4-methylphenyl)ethane-1,2-diamine |
| InChIKey | UQUZLWQGLCLOBD-HZPDHXFCSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]([C@@H](C2=CC=C(C=C2)C)N)N |
Computed by PubChem (NCBI)