Products 875740-71-9
CAS 875740-71-9 is the registry number for 1-([1,1'-Biphenyl]-4-ylmethyl)-5-(trifluoromethyl)pyridin-2(1H)-one, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
1-[(4-phenylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one (CAS 875740-71-9) is a chemical compound with the molecular formula C19H14F3NO and a molecular weight of 329.3 g/mol. IUPAC name: 1-[(4-phenylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one. InChIKey: UIHXDGHUCLDMFT-UHFFFAOYSA-N.
| Molecular formula | C19H14F3NO |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 1-[(4-phenylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| InChIKey | UIHXDGHUCLDMFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CN3C=C(C=CC3=O)C(F)(F)F |
Computed by PubChem (NCBI)