Products 877964-68-6
CAS 877964-68-6 is the registry number for 2-(Chloromethyl)-6,7,8,9-tetrahydro-5h-cyclohepta[4,5]thieno[2,3-d]pyrimidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(chloromethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (CAS 877964-68-6) is a chemical compound with the molecular formula C12H14ClN3S and a molecular weight of 267.78 g/mol. IUPAC name: 5-(chloromethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine. InChIKey: GVIHGUXIETVAQF-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3S |
|---|---|
| Molecular weight | 267.78 g/mol |
| IUPAC name | 5-(chloromethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| InChIKey | GVIHGUXIETVAQF-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)SC3=NC(=NC(=C23)N)CCl |
Computed by PubChem (NCBI)