CAS 880869-92-1 is the registry number for ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate (CAS 880869-92-1) is a chemical compound with the molecular formula C18H22BNO5 and a molecular weight of 343.2 g/mol. IUPAC name: ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate. InChIKey: YNGFPUYNNLHYHT-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO5 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate |
| InChIKey | YNGFPUYNNLHYHT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN3C(=CC=C(C3=O)C(=O)OCC)C=C2 |
Computed by PubChem (NCBI)