Products 88315-64-4

CAS 88315-64-4 is the registry number for 1S,2R)-cis-2-Methoxycarbonyl-cyclopentane-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Cis-(1S,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 88315-64-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1S,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: KYGFHAUBFNTXFK-NTSWFWBYSA-N.

Identity
Molecular formulaC8H12O4
Molecular weight172.18 g/mol
IUPAC namecis-(1S,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid
InChIKeyKYGFHAUBFNTXFK-NTSWFWBYSA-N
SMILESCOC(=O)[C@@H]1CCC[C@@H]1C(=O)O

Computed by PubChem (NCBI)