CAS 886221-74-5 is the registry number for 1-amino-3-fluoropyridin-1-ium 2,4,6-trimethylbenzenesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-fluoropyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (CAS 886221-74-5) is a chemical compound with the molecular formula C14H17FN2O3S and a molecular weight of 312.36 g/mol. IUPAC name: 3-fluoropyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate. InChIKey: ZEIJSUSYZPSKLE-UHFFFAOYSA-M.
| Molecular formula | C14H17FN2O3S |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | 3-fluoropyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| InChIKey | ZEIJSUSYZPSKLE-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)[O-])C.C1=CC(=C[N+](=C1)N)F |
Computed by PubChem (NCBI)