CAS 887567-78-4 is the registry number for 3-Bromo-4,6-difluoro-1H-indazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-4,6-difluoro-2H-indazole (CAS 887567-78-4) is a chemical compound with the molecular formula C7H3BrF2N2 and a molecular weight of 233.01 g/mol. IUPAC name: 3-bromo-4,6-difluoro-2H-indazole. InChIKey: OMGZJDWENSGDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2N2 |
|---|---|
| Molecular weight | 233.01 g/mol |
| IUPAC name | 3-bromo-4,6-difluoro-2H-indazole |
| InChIKey | OMGZJDWENSGDAU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)Br)F)F |
Computed by PubChem (NCBI)