Products 889116-06-7
CAS 889116-06-7 is the registry number for LY-2300559. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(S)-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-hydroxymethyl]benzoic acid (CAS 889116-06-7) is a chemical compound with the molecular formula C26H26O6 and a molecular weight of 434.5 g/mol. IUPAC name: 3-[(S)-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-hydroxymethyl]benzoic acid. InChIKey: DWQVYDLTPMGYNE-DEOSSOPVSA-N.
| Molecular formula | C26H26O6 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | 3-[(S)-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-hydroxymethyl]benzoic acid |
| InChIKey | DWQVYDLTPMGYNE-DEOSSOPVSA-N |
| SMILES | CCCC1=C(C=CC(=C1O)C(=O)C)OCC2=CC=C(C=C2)[C@@H](C3=CC(=CC=C3)C(=O)O)O |
Computed by PubChem (NCBI)