CAS 89051-47-8 is the registry number for Tazobactam Acid Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 89051-47-8) is a chemical compound with the molecular formula C21H20N4O3S and a molecular weight of 408.5 g/mol. IUPAC name: benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: QDENRCNQLGQIRL-LMNJBCLMSA-N.
| Molecular formula | C21H20N4O3S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | QDENRCNQLGQIRL-LMNJBCLMSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1)CC2=O)C(=O)OC(C3=CC=CC=C3)C4=CC=CC=C4)CN=[N+]=[N-] |
Computed by PubChem (NCBI)