Products 892592-83-5

CAS 892592-83-5 is the registry number for 3-Phenylpropanimidamide hydrobromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-phenylpropanimidamide;hydrobromide (CAS 892592-83-5) is a chemical compound with the molecular formula C9H13BrN2 and a molecular weight of 229.12 g/mol. IUPAC name: 3-phenylpropanimidamide;hydrobromide. InChIKey: VSIZYCLSTMPIPT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BrN2
Molecular weight229.12 g/mol
IUPAC name3-phenylpropanimidamide;hydrobromide
InChIKeyVSIZYCLSTMPIPT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(=N)N.Br

Computed by PubChem (NCBI)