Products 89692-74-0

CAS 89692-74-0 is the registry number for 4-(chlorocarbonyl)benzenesulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-carbonochloridoylbenzenesulfonic acid (CAS 89692-74-0) is a chemical compound with the molecular formula C7H5ClO4S and a molecular weight of 220.63 g/mol. IUPAC name: 4-carbonochloridoylbenzenesulfonic acid. InChIKey: PJZSMROVPKGXBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClO4S
Molecular weight220.63 g/mol
IUPAC name4-carbonochloridoylbenzenesulfonic acid
InChIKeyPJZSMROVPKGXBZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)Cl)S(=O)(=O)O

Computed by PubChem (NCBI)