Products 9013-31-4
CAS 9013-31-4 appears in our catalog under these names: Apoferritin, APOFERRITIN FROM EQUINE SPLEEN, APOFERRITIN,HORSE SPLEEN, FOR GEL FILTRA, Ferritin, Apo-, Equine Splee 1PC X 100MG. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1G, 1VL, 5X1VL.
8-(3a,6,6,9a-tetramethyl-2,7-dioxo-4,5,5a,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene)-4-methylnona-2,4,6-trienoic acid (CAS 9013-31-4) is a chemical compound with the molecular formula C27H36O4 and a molecular weight of 424.6 g/mol. IUPAC name: 8-(3a,6,6,9a-tetramethyl-2,7-dioxo-4,5,5a,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene)-4-methylnona-2,4,6-trienoic acid. InChIKey: UYRFYSXXHBUZRL-UHFFFAOYSA-N.
| Molecular formula | C27H36O4 |
|---|---|
| Molecular weight | 424.6 g/mol |
| IUPAC name | 8-(3a,6,6,9a-tetramethyl-2,7-dioxo-4,5,5a,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene)-4-methylnona-2,4,6-trienoic acid |
| InChIKey | UYRFYSXXHBUZRL-UHFFFAOYSA-N |
| SMILES | CC(=CC=CC(=C1C(=O)CC2C1(CCC3C2(CCC(=O)C3(C)C)C)C)C)C=CC(=O)O |
Computed by PubChem (NCBI)