Products 90410-90-5
CAS 90410-90-5 appears in our catalog under these names: Doxorubicin Impurity 29, Doxorubicin Impurity 30, Doxorubicin Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(7R,9S)-9-acetyl-6,9,11-trihydroxy-4,7-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione (CAS 90410-90-5) is a chemical compound with the molecular formula C22H20O8 and a molecular weight of 412.4 g/mol. IUPAC name: (7R,9S)-9-acetyl-6,9,11-trihydroxy-4,7-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione. InChIKey: KNOQOVLUFXRUOF-DMZKTXOQSA-N.
| Molecular formula | C22H20O8 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (7R,9S)-9-acetyl-6,9,11-trihydroxy-4,7-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| InChIKey | KNOQOVLUFXRUOF-DMZKTXOQSA-N |
| SMILES | CC(=O)[C@]1(C[C@H](C2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4OC)O)OC)O |
Computed by PubChem (NCBI)