CAS 910661-33-5 appears in our catalog under these names: N2-(4-(((2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl)amino)benzoyl)-N-(2-((((3',6'-dihydroxy-3-oxospiro(isobenzofuran-1(3H),9'-(9H )xanthen)-5-yl)amino)thioxomethyl)amino)ethyl)-L-glutamine disodium salt, EC-17 (disodium salt), 96.21%, 96.21%, EC-17 (disodium salt), 96.30%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1mg, 50 mg, 5 mg, 25 mg.
CAS 910661-33-5 identifies a chemical compound with the molecular formula C42H38N10NaO10S and a molecular weight of 897.9 g/mol. InChIKey: LHFHTILJSBWECG-ARIINYJRSA-N.
| Molecular formula | C42H38N10NaO10S |
|---|---|
| Molecular weight | 897.9 g/mol |
| InChIKey | LHFHTILJSBWECG-ARIINYJRSA-N |
| SMILES | [HH].C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)NCCNC(=S)NC2=CC3=C(C=C2)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC3=O)C(=O)O)NCC7=CN=C8C(=N7)C(=O)NC(=N8)N.[Na] |
Computed by PubChem (NCBI)