CAS 913682-76-5 is the registry number for 3,4-DIFLUORO-2-METHOXY-4''-PROPYL-1,1':4',1''-TERPHENYL, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-difluoro-3-methoxy-4-[4-(4-propylphenyl)phenyl]benzene (CAS 913682-76-5) is a chemical compound with the molecular formula C22H20F2O and a molecular weight of 338.4 g/mol. IUPAC name: 1,2-difluoro-3-methoxy-4-[4-(4-propylphenyl)phenyl]benzene. InChIKey: NALYVBWZMRLKRN-UHFFFAOYSA-N.
| Molecular formula | C22H20F2O |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 1,2-difluoro-3-methoxy-4-[4-(4-propylphenyl)phenyl]benzene |
| InChIKey | NALYVBWZMRLKRN-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C3=C(C(=C(C=C3)F)F)OC |
Computed by PubChem (NCBI)