Products 914458-48-3
CAS 914458-48-3 is the registry number for Naphthalen-1-yl(5-phenyl-1H-pyrrol-3-yl)methanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
Naphthalen-1-yl-(5-phenyl-1H-pyrrol-3-yl)methanone (CAS 914458-48-3) is a chemical compound with the molecular formula C21H15NO and a molecular weight of 297.3 g/mol. IUPAC name: naphthalen-1-yl-(5-phenyl-1H-pyrrol-3-yl)methanone. InChIKey: UYGWRELGKKLPSC-UHFFFAOYSA-N.
| Molecular formula | C21H15NO |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | naphthalen-1-yl-(5-phenyl-1H-pyrrol-3-yl)methanone |
| InChIKey | UYGWRELGKKLPSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN2)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)