Products 922529-63-3
CAS 922529-63-3 is the registry number for tert-Butyl (S)-2-((2-chloro-4-(methoxycarbonyl)phenoxy)methyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-[(2-chloro-4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate (CAS 922529-63-3) is a chemical compound with the molecular formula C18H24ClNO5 and a molecular weight of 369.8 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-chloro-4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate. InChIKey: ZBNXYOYWMHRGHE-ZDUSSCGKSA-N.
| Molecular formula | C18H24ClNO5 |
|---|---|
| Molecular weight | 369.8 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-chloro-4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate |
| InChIKey | ZBNXYOYWMHRGHE-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COC2=C(C=C(C=C2)C(=O)OC)Cl |
Computed by PubChem (NCBI)