CAS 92315-49-6 is the registry number for 3-Methoxy-2,5-dimethylbenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-methoxy-2,5-dimethylbenzoic acid (CAS 92315-49-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-methoxy-2,5-dimethylbenzoic acid. InChIKey: SUSSFYUYIFADRR-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-methoxy-2,5-dimethylbenzoic acid |
| InChIKey | SUSSFYUYIFADRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C)C(=O)O |
Computed by PubChem (NCBI)