Products 929562-82-3

CAS 929562-82-3 is the registry number for (2R,3S)-3-methylazetidine-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(2R,3S)-3-methylazetidine-2-carboxylic acid (CAS 929562-82-3) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. IUPAC name: (2R,3S)-3-methylazetidine-2-carboxylic acid. InChIKey: WDWMCQMMMOWQAP-IUYQGCFVSA-N.

Identity
Molecular formulaC5H9NO2
Molecular weight115.13 g/mol
IUPAC name(2R,3S)-3-methylazetidine-2-carboxylic acid
InChIKeyWDWMCQMMMOWQAP-IUYQGCFVSA-N
SMILESC[C@H]1CN[C@H]1C(=O)O

Computed by PubChem (NCBI)