CAS 932520-32-6 is the registry number for Ethyl 3-((4-(3-methoxyphenyl)piperazin-1-yl)sulfonyl)benzo[b]thiophene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate (CAS 932520-32-6) is a chemical compound with the molecular formula C22H24N2O5S2 and a molecular weight of 460.6 g/mol. IUPAC name: ethyl 3-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate. InChIKey: BRMJQTDALUVFFD-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O5S2 |
|---|---|
| Molecular weight | 460.6 g/mol |
| IUPAC name | ethyl 3-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate |
| InChIKey | BRMJQTDALUVFFD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2S1)S(=O)(=O)N3CCN(CC3)C4=CC(=CC=C4)OC |
Computed by PubChem (NCBI)