Products 942199-60-2

CAS 942199-60-2 is the registry number for 4-Chloro-3-methoxybenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-3-methoxybenzenesulfonyl chloride (CAS 942199-60-2) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 4-chloro-3-methoxybenzenesulfonyl chloride. InChIKey: RHOMFRDKCUYVOH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O3S
Molecular weight241.09 g/mol
IUPAC name4-chloro-3-methoxybenzenesulfonyl chloride
InChIKeyRHOMFRDKCUYVOH-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)