CAS 945723-71-7 is the registry number for 2-Iodo-4-Phenylpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-iodo-4-phenylpyridine (CAS 945723-71-7) is a chemical compound with the molecular formula C11H8IN and a molecular weight of 281.09 g/mol. IUPAC name: 2-iodo-4-phenylpyridine. InChIKey: KGCWPNRJYXLKNN-UHFFFAOYSA-N.
| Molecular formula | C11H8IN |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 2-iodo-4-phenylpyridine |
| InChIKey | KGCWPNRJYXLKNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)I |
Computed by PubChem (NCBI)