Products 945837-75-2

CAS 945837-75-2 is the registry number for (4-(3-Ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 945837-75-2) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: OVNZUEJWYIMMSW-VMPITWQZSA-N.

Identity
Molecular formulaC11H13BO4
Molecular weight220.03 g/mol
IUPAC name[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid
InChIKeyOVNZUEJWYIMMSW-VMPITWQZSA-N
SMILESB(C1=CC=C(C=C1)/C=C/C(=O)OCC)(O)O

Computed by PubChem (NCBI)