Products 946785-13-3
CAS 946785-13-3 is the registry number for 4-(3-Fluorophenoxy)-3-methylaniline. Offered by: TRC. Available pack sizes: 2,5g.
4-(3-fluorophenoxy)-3-methylaniline (CAS 946785-13-3) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: 4-(3-fluorophenoxy)-3-methylaniline. InChIKey: RARDBJBURJNNEY-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 4-(3-fluorophenoxy)-3-methylaniline |
| InChIKey | RARDBJBURJNNEY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)OC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)