CAS 951127-17-6 appears in our catalog under these names: Omarigliptin Impurity 1, Desmethylsulfonyl-Omarigliptin. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride (CAS 951127-17-6) is a chemical compound with the molecular formula C16H20Cl2F2N4O and a molecular weight of 393.3 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride. InChIKey: UFLXBTOVPRBSCI-UHFFFAOYSA-N.
| Molecular formula | C16H20Cl2F2N4O |
|---|---|
| Molecular weight | 393.3 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride |
| InChIKey | UFLXBTOVPRBSCI-UHFFFAOYSA-N |
| SMILES | C1C(COC(C1N)C2=C(C=CC(=C2)F)F)N3CC4=C(C3)NN=C4.Cl.Cl |
Computed by PubChem (NCBI)