Products 952604-30-7

CAS 952604-30-7 is the registry number for (4-(10-Phenylanthracen-9-yl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-(10-phenylanthracen-9-yl)phenyl]boronic acid (CAS 952604-30-7) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: [4-(10-phenylanthracen-9-yl)phenyl]boronic acid. InChIKey: YNDGEMZBYUVHTH-UHFFFAOYSA-N.

Identity
Molecular formulaC26H19BO2
Molecular weight374.2 g/mol
IUPAC name[4-(10-phenylanthracen-9-yl)phenyl]boronic acid
InChIKeyYNDGEMZBYUVHTH-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5)(O)O

Computed by PubChem (NCBI)