Products 954228-36-5
CAS 954228-36-5 is the registry number for 1-(2-Chloropyrimidin-4-yl)pyrrolidin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(2-chloropyrimidin-4-yl)pyrrolidin-3-ol (CAS 954228-36-5) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 1-(2-chloropyrimidin-4-yl)pyrrolidin-3-ol. InChIKey: DLZHVZSXNBBQKW-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 1-(2-chloropyrimidin-4-yl)pyrrolidin-3-ol |
| InChIKey | DLZHVZSXNBBQKW-UHFFFAOYSA-N |
| SMILES | C1CN(CC1O)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)