CAS 954565-99-2 appears in our catalog under these names: 3,4-Dihydronaphthalene-2-sulfonamide, 3,4-Dihydronaphthalene-2-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3,4-dihydronaphthalene-2-sulfonamide (CAS 954565-99-2) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 3,4-dihydronaphthalene-2-sulfonamide. InChIKey: HNARYJMYPMJFET-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 3,4-dihydronaphthalene-2-sulfonamide |
| InChIKey | HNARYJMYPMJFET-UHFFFAOYSA-N |
| SMILES | C1CC(=CC2=CC=CC=C21)S(=O)(=O)N |
Computed by PubChem (NCBI)